About 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline
2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline (PubChem CID 70098732) has the molecular formula C21H15F2N5
and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline.
Molecular Properties
| Compound Name | 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline |
| PubChem CID | 70098732 |
| Molecular Formula | C21H15F2N5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline |
| SMILES | Cn1c(CCc2cnc3c(F)ccc(F)c3n2)nc2c3cccnc3ccc21 |
| InChI | InChI=1S/C21H15F2N5/c1-28-17-8-7-16-13(3-2-10-24-16)19(17)27-18(28)9-4-12-11-25-20-14(22)5-6-15(23)21(20)26-12/h2-3,5-8,10-11H,4,9H2,1H3 |
| InChIKey | SJEFTMMIIBPYNY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline?
The IUPAC name of 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline (CID 70098732) is 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline.
What is the SMILES notation for 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline?
The canonical SMILES for 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline is Cn1c(CCc2cnc3c(F)ccc(F)c3n2)nc2c3cccnc3ccc21.
What is the InChIKey of 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline?
The InChIKey is SJEFTMMIIBPYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F2N5/c1-28-17-8-7-16-13(3-2-10-24-16)19(17)27-18(28)9-4-12-11-25-20-14(22)5-6-15(23)21(20)26-12/h2-3,5-8,10-11H,4,9H2,1H3.
What are the key properties of 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline?
2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline has a molecular weight of 375.38 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5,8-difluoroquinoxalin-2-yl)ethyl]-3-methylimidazo[4,5-f]quinoline is sourced from PubChem (CID 70098732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).