C36H46Cl2N8O4 — CID 70099631
2-[3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol;2-[4-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol (PubChem CID 70099631) has the molecular formula C36H46Cl2N8O4 and a molecular weight of 725.72 g/mol. Its IUPAC name is 2-[3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol;2-[4-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol.
| Compound Name | 2-[3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol;2-[4-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol |
|---|---|
| PubChem CID | 70099631 |
| Molecular Formula | C36H46Cl2N8O4 |
| Molecular Weight | 725.72 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | 2-[3-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol;2-[4-[[2-amino-5-(4-chlorophenoxy)pyrimidin-4-yl]amino]cyclohexyl]ethanol |
| SMILES | Nc1ncc(Oc2ccc(Cl)cc2)c(NC2CCC(CCO)CC2)n1.Nc1ncc(Oc2ccc(Cl)cc2)c(NC2CCCC(CCO)C2)n1 |
| InChI | InChI=1S/2C18H23ClN4O2/c19-13-3-7-15(8-4-13)25-16-11-21-18(20)23-17(16)22-14-5-1-12(2-6-14)9-10-24;19-13-4-6-15(7-5-13)25-16-11-21-18(20)23-17(16)22-14-3-1-2-12(10-14)8-9-24/h3-4,7-8,11-12,14,24H,1-2,5-6,9-10H2,(H3,20,21,22,23);4-7,11-12,14,24H,1-3,8-10H2,(H3,20,21,22,23) |
| InChIKey | YTSGVUMVAJRPEZ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 186.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.72 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |