C17H20O4S — CID 70099709
(3aR,5aR,6aR,6bS)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole (PubChem CID 70099709) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is (3aR,5aR,6aR,6bS)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole.
| Compound Name | (3aR,5aR,6aR,6bS)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole |
|---|---|
| PubChem CID | 70099709 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (3aR,5aR,6aR,6bS)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole |
| SMILES | Cc1ccc(S(=O)(=O)C2[C@H]3[C@@H]4OC(C)(C)O[C@@H]4C=C[C@@H]23)cc1 |
| InChI | InChI=1S/C17H20O4S/c1-10-4-6-11(7-5-10)22(18,19)16-12-8-9-13-15(14(12)16)21-17(2,3)20-13/h4-9,12-16H,1-3H3/t12-,13-,14-,15-,16?/m1/s1 |
| InChIKey | MYSGPZXWZTXLMM-XIHUBIEQSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|