About 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran
7-bromo-5-chloro-2,3-dimethyl-1-benzofuran (PubChem CID 70099763) has the molecular formula C10H8BrClO
and a molecular weight of 259.53 g/mol. Its IUPAC name is 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran |
| PubChem CID | 70099763 |
| Molecular Formula | C10H8BrClO |
| Molecular Weight | 259.53 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran |
| SMILES | Cc1oc2c(Br)cc(Cl)cc2c1C |
| InChI | InChI=1S/C10H8BrClO/c1-5-6(2)13-10-8(5)3-7(12)4-9(10)11/h3-4H,1-2H3 |
| InChIKey | OODIYZQVXDYCAW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran?
The IUPAC name of 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran (CID 70099763) is 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran.
What is the SMILES notation for 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran?
The canonical SMILES for 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran is Cc1oc2c(Br)cc(Cl)cc2c1C.
What is the InChIKey of 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran?
The InChIKey is OODIYZQVXDYCAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrClO/c1-5-6(2)13-10-8(5)3-7(12)4-9(10)11/h3-4H,1-2H3.
What are the key properties of 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran?
7-bromo-5-chloro-2,3-dimethyl-1-benzofuran has a molecular weight of 259.53 g/mol, XLogP of 4.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-chloro-2,3-dimethyl-1-benzofuran is sourced from PubChem (CID 70099763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).