About 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole
1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole (PubChem CID 70100436) has the molecular formula C24H25NOS2
and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole.
Molecular Properties
| Compound Name | 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole |
| PubChem CID | 70100436 |
| Molecular Formula | C24H25NOS2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole |
| SMILES | CCCC(CC)Oc1ccc(-n2c(-c3cccs3)ccc2-c2cccs2)cc1 |
| InChI | InChI=1S/C24H25NOS2/c1-3-7-19(4-2)26-20-12-10-18(11-13-20)25-21(23-8-5-16-27-23)14-15-22(25)24-9-6-17-28-24/h5-6,8-17,19H,3-4,7H2,1-2H3 |
| InChIKey | HMLLFBDULWYENZ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole?
The IUPAC name of 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole (CID 70100436) is 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole.
What is the SMILES notation for 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole?
The canonical SMILES for 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole is CCCC(CC)Oc1ccc(-n2c(-c3cccs3)ccc2-c2cccs2)cc1.
What is the InChIKey of 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole?
The InChIKey is HMLLFBDULWYENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NOS2/c1-3-7-19(4-2)26-20-12-10-18(11-13-20)25-21(23-8-5-16-27-23)14-15-22(25)24-9-6-17-28-24/h5-6,8-17,19H,3-4,7H2,1-2H3.
What are the key properties of 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole?
1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole has a molecular weight of 407.60 g/mol, XLogP of 7.89, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hexan-3-yloxyphenyl)-2,5-dithiophen-2-ylpyrrole is sourced from PubChem (CID 70100436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).