About 7-N,7-dimethyl-1H-quinazoline-2,7-diamine
7-N,7-dimethyl-1H-quinazoline-2,7-diamine (PubChem CID 70100778) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 7-N,7-dimethyl-1H-quinazoline-2,7-diamine.
Molecular Properties
| Compound Name | 7-N,7-dimethyl-1H-quinazoline-2,7-diamine |
| PubChem CID | 70100778 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 7-N,7-dimethyl-1H-quinazoline-2,7-diamine |
| SMILES | CNC1(C)C=CC2=CN=C(N)NC2=C1 |
| InChI | InChI=1S/C10H14N4/c1-10(12-2)4-3-7-6-13-9(11)14-8(7)5-10/h3-6,12H,1-2H3,(H3,11,13,14) |
| InChIKey | ADRACDXJMNQASY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-N,7-dimethyl-1H-quinazoline-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N,7-dimethyl-1H-quinazoline-2,7-diamine?
The IUPAC name of 7-N,7-dimethyl-1H-quinazoline-2,7-diamine (CID 70100778) is 7-N,7-dimethyl-1H-quinazoline-2,7-diamine.
What is the SMILES notation for 7-N,7-dimethyl-1H-quinazoline-2,7-diamine?
The canonical SMILES for 7-N,7-dimethyl-1H-quinazoline-2,7-diamine is CNC1(C)C=CC2=CN=C(N)NC2=C1.
What is the InChIKey of 7-N,7-dimethyl-1H-quinazoline-2,7-diamine?
The InChIKey is ADRACDXJMNQASY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-10(12-2)4-3-7-6-13-9(11)14-8(7)5-10/h3-6,12H,1-2H3,(H3,11,13,14).
What are the key properties of 7-N,7-dimethyl-1H-quinazoline-2,7-diamine?
7-N,7-dimethyl-1H-quinazoline-2,7-diamine has a molecular weight of 190.25 g/mol, XLogP of 0.22, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N,7-dimethyl-1H-quinazoline-2,7-diamine is sourced from PubChem (CID 70100778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).