About [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate
[(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate (PubChem CID 70100789) has the molecular formula C23H25NO5
and a molecular weight of 395.46 g/mol. Its IUPAC name is [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate |
| PubChem CID | 70100789 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@@H]1CCCN(CCC=C2c3ccccc3OCOc3ccccc32)C1 |
| InChI | InChI=1S/C23H25NO5/c25-23(26)29-17-7-5-13-24(15-17)14-6-10-18-19-8-1-3-11-21(19)27-16-28-22-12-4-2-9-20(18)22/h1-4,8-12,17H,5-7,13-16H2,(H,25,26)/t17-/m1/s1 |
| InChIKey | WXBLJXVEKJPOJF-QGZVFWFLSA-N |
| XLogP | 4.40 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate?
The IUPAC name of [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate (CID 70100789) is [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate.
What is the SMILES notation for [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate?
The canonical SMILES for [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate is O=C(O)O[C@@H]1CCCN(CCC=C2c3ccccc3OCOc3ccccc32)C1.
What is the InChIKey of [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate?
The InChIKey is WXBLJXVEKJPOJF-QGZVFWFLSA-N. The full InChI is InChI=1S/C23H25NO5/c25-23(26)29-17-7-5-13-24(15-17)14-6-10-18-19-8-1-3-11-21(19)27-16-28-22-12-4-2-9-20(18)22/h1-4,8-12,17H,5-7,13-16H2,(H,25,26)/t17-/m1/s1.
What are the key properties of [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate?
[(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate has a molecular weight of 395.46 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-(3-benzo[d][1,3]benzodioxocin-5-ylidenepropyl)piperidin-3-yl] hydrogen carbonate is sourced from PubChem (CID 70100789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).