About 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole
2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole (PubChem CID 70101397) has the molecular formula C21H14F4N2
and a molecular weight of 370.35 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole |
| PubChem CID | 70101397 |
| Molecular Formula | C21H14F4N2 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole |
| SMILES | Cc1cc(Cc2c(F)cccc2F)c2nc(-c3c(F)cccc3F)[nH]c2c1 |
| InChI | InChI=1S/C21H14F4N2/c1-11-8-12(10-13-14(22)4-2-5-15(13)23)20-18(9-11)26-21(27-20)19-16(24)6-3-7-17(19)25/h2-9H,10H2,1H3,(H,26,27) |
| InChIKey | ICODPBUDCLKEHG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole?
The IUPAC name of 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole (CID 70101397) is 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole.
What is the SMILES notation for 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole?
The canonical SMILES for 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole is Cc1cc(Cc2c(F)cccc2F)c2nc(-c3c(F)cccc3F)[nH]c2c1.
What is the InChIKey of 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole?
The InChIKey is ICODPBUDCLKEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F4N2/c1-11-8-12(10-13-14(22)4-2-5-15(13)23)20-18(9-11)26-21(27-20)19-16(24)6-3-7-17(19)25/h2-9H,10H2,1H3,(H,26,27).
What are the key properties of 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole?
2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole has a molecular weight of 370.35 g/mol, XLogP of 5.69, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-4-[(2,6-difluorophenyl)methyl]-6-methyl-1H-benzimidazole is sourced from PubChem (CID 70101397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).