About CID 70102370
CID 70102370 (PubChem CID 70102370) has the molecular formula C16H23N2O5Si
and a molecular weight of 351.46 g/mol.
Molecular Properties
| Compound Name | CID 70102370 |
| PubChem CID | 70102370 |
| Molecular Formula | C16H23N2O5Si |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(CC1Oc2cc([N+](=O)[O-])ccc2NC1=O)C(C)(C)C |
| InChI | InChI=1S/C16H23N2O5Si/c1-16(2,3)14(23-24(4)5)9-13-15(19)17-11-7-6-10(18(20)21)8-12(11)22-13/h6-8,13-14H,9H2,1-5H3,(H,17,19) |
| InChIKey | IYBKDDUVWKMYOW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 70102370 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70102370?
The IUPAC name of CID 70102370 (CID 70102370) is not available.
What is the SMILES notation for CID 70102370?
The canonical SMILES for CID 70102370 is C[Si](C)OC(CC1Oc2cc([N+](=O)[O-])ccc2NC1=O)C(C)(C)C.
What is the InChIKey of CID 70102370?
The InChIKey is IYBKDDUVWKMYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N2O5Si/c1-16(2,3)14(23-24(4)5)9-13-15(19)17-11-7-6-10(18(20)21)8-12(11)22-13/h6-8,13-14H,9H2,1-5H3,(H,17,19).
What are the key properties of CID 70102370?
CID 70102370 has a molecular weight of 351.46 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70102370 is sourced from PubChem (CID 70102370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).