About 10-aminothieno[2,3-c][1]benzazepin-4-one
10-aminothieno[2,3-c][1]benzazepin-4-one (PubChem CID 70103346) has the molecular formula C12H8N2OS
and a molecular weight of 228.28 g/mol. Its IUPAC name is 10-aminothieno[2,3-c][1]benzazepin-4-one.
Molecular Properties
| Compound Name | 10-aminothieno[2,3-c][1]benzazepin-4-one |
| PubChem CID | 70103346 |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 10-aminothieno[2,3-c][1]benzazepin-4-one |
| SMILES | Nc1c2ccccc2nc(=O)c2sccc12 |
| InChI | InChI=1S/C12H8N2OS/c13-10-7-3-1-2-4-9(7)14-12(15)11-8(10)5-6-16-11/h1-6H,13H2 |
| InChIKey | YOYZMMICLSNKII-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-aminothieno[2,3-c][1]benzazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-aminothieno[2,3-c][1]benzazepin-4-one?
The IUPAC name of 10-aminothieno[2,3-c][1]benzazepin-4-one (CID 70103346) is 10-aminothieno[2,3-c][1]benzazepin-4-one.
What is the SMILES notation for 10-aminothieno[2,3-c][1]benzazepin-4-one?
The canonical SMILES for 10-aminothieno[2,3-c][1]benzazepin-4-one is Nc1c2ccccc2nc(=O)c2sccc12.
What is the InChIKey of 10-aminothieno[2,3-c][1]benzazepin-4-one?
The InChIKey is YOYZMMICLSNKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2OS/c13-10-7-3-1-2-4-9(7)14-12(15)11-8(10)5-6-16-11/h1-6H,13H2.
What are the key properties of 10-aminothieno[2,3-c][1]benzazepin-4-one?
10-aminothieno[2,3-c][1]benzazepin-4-one has a molecular weight of 228.28 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-aminothieno[2,3-c][1]benzazepin-4-one is sourced from PubChem (CID 70103346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).