About 4-sulfamoylbenzoyl chloride
4-sulfamoylbenzoyl chloride (PubChem CID 7010340) has the molecular formula C7H6ClNO3S
and a molecular weight of 219.65 g/mol. Its IUPAC name is 4-sulfamoylbenzoyl chloride.
Molecular Properties
| Compound Name | 4-sulfamoylbenzoyl chloride |
| PubChem CID | 7010340 |
| Molecular Formula | C7H6ClNO3S |
| Molecular Weight | 219.65 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | 4-sulfamoylbenzoyl chloride |
| SMILES | NS(=O)(=O)c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C7H6ClNO3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H,(H2,9,11,12) |
| InChIKey | SOSVTEHBZNSARP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.65 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfamoylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfamoylbenzoyl chloride?
The IUPAC name of 4-sulfamoylbenzoyl chloride (CID 7010340) is 4-sulfamoylbenzoyl chloride.
What is the SMILES notation for 4-sulfamoylbenzoyl chloride?
The canonical SMILES for 4-sulfamoylbenzoyl chloride is NS(=O)(=O)c1ccc(C(=O)Cl)cc1.
What is the InChIKey of 4-sulfamoylbenzoyl chloride?
The InChIKey is SOSVTEHBZNSARP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H,(H2,9,11,12).
What are the key properties of 4-sulfamoylbenzoyl chloride?
4-sulfamoylbenzoyl chloride has a molecular weight of 219.65 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfamoylbenzoyl chloride is sourced from PubChem (CID 7010340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).