About 2-(dimethylamino)acetyl chloride
2-(dimethylamino)acetyl chloride (PubChem CID 7010344) has the molecular formula C4H8ClNO
and a molecular weight of 121.57 g/mol. Its IUPAC name is 2-(dimethylamino)acetyl chloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)acetyl chloride |
| PubChem CID | 7010344 |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.57 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 2-(dimethylamino)acetyl chloride |
| SMILES | CN(C)CC(=O)Cl |
| InChI | InChI=1S/C4H8ClNO/c1-6(2)3-4(5)7/h3H2,1-2H3 |
| InChIKey | VTYRPALGSNDUQQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.57 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)acetyl chloride?
The IUPAC name of 2-(dimethylamino)acetyl chloride (CID 7010344) is 2-(dimethylamino)acetyl chloride.
What is the SMILES notation for 2-(dimethylamino)acetyl chloride?
The canonical SMILES for 2-(dimethylamino)acetyl chloride is CN(C)CC(=O)Cl.
What is the InChIKey of 2-(dimethylamino)acetyl chloride?
The InChIKey is VTYRPALGSNDUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO/c1-6(2)3-4(5)7/h3H2,1-2H3.
What are the key properties of 2-(dimethylamino)acetyl chloride?
2-(dimethylamino)acetyl chloride has a molecular weight of 121.57 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)acetyl chloride is sourced from PubChem (CID 7010344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).