C20H22F3N3O2 — CID 70104507
3-[[[(2R,3S)-2-phenylpiperidin-3-yl]amino]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 70104507) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-[[[(2R,3S)-2-phenylpiperidin-3-yl]amino]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-[[[(2R,3S)-2-phenylpiperidin-3-yl]amino]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 70104507 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[[[(2R,3S)-2-phenylpiperidin-3-yl]amino]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | NC(=O)c1ccc(OC(F)(F)F)c(CN[C@H]2CCCN[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C20H22F3N3O2/c21-20(22,23)28-17-9-8-14(19(24)27)11-15(17)12-26-16-7-4-10-25-18(16)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,16,18,25-26H,4,7,10,12H2,(H2,24,27)/t16-,18+/m0/s1 |
| InChIKey | QFYGFHNCJJEBAD-FUHWJXTLSA-N |
| XLogP | 3.27 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |