About 2H-triazol-4-yl hydrogen carbonate
2H-triazol-4-yl hydrogen carbonate (PubChem CID 70104519) has the molecular formula C3H3N3O3
and a molecular weight of 129.07 g/mol. Its IUPAC name is 2H-triazol-4-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 2H-triazol-4-yl hydrogen carbonate |
| PubChem CID | 70104519 |
| Molecular Formula | C3H3N3O3 |
| Molecular Weight | 129.07 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | 2H-triazol-4-yl hydrogen carbonate |
| SMILES | O=C(O)Oc1cn[nH]n1 |
| InChI | InChI=1S/C3H3N3O3/c7-3(8)9-2-1-4-6-5-2/h1H,(H,7,8)(H,4,5,6) |
| InChIKey | YRALKKFJHCYUFI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.07 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-triazol-4-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-triazol-4-yl hydrogen carbonate?
The IUPAC name of 2H-triazol-4-yl hydrogen carbonate (CID 70104519) is 2H-triazol-4-yl hydrogen carbonate.
What is the SMILES notation for 2H-triazol-4-yl hydrogen carbonate?
The canonical SMILES for 2H-triazol-4-yl hydrogen carbonate is O=C(O)Oc1cn[nH]n1.
What is the InChIKey of 2H-triazol-4-yl hydrogen carbonate?
The InChIKey is YRALKKFJHCYUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O3/c7-3(8)9-2-1-4-6-5-2/h1H,(H,7,8)(H,4,5,6).
What are the key properties of 2H-triazol-4-yl hydrogen carbonate?
2H-triazol-4-yl hydrogen carbonate has a molecular weight of 129.07 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-triazol-4-yl hydrogen carbonate is sourced from PubChem (CID 70104519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).