C28H20N6S2+2 — CID 70104935
3-methyl-2-[3-(3-methyl-1,3-thiazol-3-ium-2-yl)porphyrin-2-yl]-1,3-thiazol-3-ium (PubChem CID 70104935) has the molecular formula C28H20N6S2+2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 3-methyl-2-[3-(3-methyl-1,3-thiazol-3-ium-2-yl)porphyrin-2-yl]-1,3-thiazol-3-ium.
| Compound Name | 3-methyl-2-[3-(3-methyl-1,3-thiazol-3-ium-2-yl)porphyrin-2-yl]-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 70104935 |
| Molecular Formula | C28H20N6S2+2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 3-methyl-2-[3-(3-methyl-1,3-thiazol-3-ium-2-yl)porphyrin-2-yl]-1,3-thiazol-3-ium |
| SMILES | C[n+]1ccsc1C1=C(c2scc[n+]2C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C28H20N6S2/c1-33-9-11-35-27(33)25-23-15-21-7-5-19(30-21)13-17-3-4-18(29-17)14-20-6-8-22(31-20)16-24(32-23)26(25)28-34(2)10-12-36-28/h3-16H,1-2H3/q+2/b17-13-,18-14-,19-13-,20-14-,21-15-,22-16-,23-15-,24-16- |
| InChIKey | PAYUVGCERAVOEH-PTVSIUTBSA-N |
| XLogP | 4.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|