C9H19N3O3 — CID 7010504
(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid (PubChem CID 7010504) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 7010504 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C9H19N3O3/c1-6(9(14)15)12-8(13)7(11)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7-/m0/s1 |
| InChIKey | QOOWRKBDDXQRHC-BQBZGAKWSA-N |
| XLogP | -0.97 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|