About 7,8-dihydro-6H-pentaleno[1,2-b]pyran
7,8-dihydro-6H-pentaleno[1,2-b]pyran (PubChem CID 70105470) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 7,8-dihydro-6H-pentaleno[1,2-b]pyran.
Molecular Properties
| Compound Name | 7,8-dihydro-6H-pentaleno[1,2-b]pyran |
| PubChem CID | 70105470 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 7,8-dihydro-6H-pentaleno[1,2-b]pyran |
| SMILES | c1coc2c3c(cc-2c1)CCC3 |
| InChI | InChI=1S/C11H10O/c1-3-8-7-9-4-2-6-12-11(9)10(8)5-1/h2,4,6-7H,1,3,5H2 |
| InChIKey | ZZQREDGFEHKPOV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-dihydro-6H-pentaleno[1,2-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-6H-pentaleno[1,2-b]pyran?
The IUPAC name of 7,8-dihydro-6H-pentaleno[1,2-b]pyran (CID 70105470) is 7,8-dihydro-6H-pentaleno[1,2-b]pyran.
What is the SMILES notation for 7,8-dihydro-6H-pentaleno[1,2-b]pyran?
The canonical SMILES for 7,8-dihydro-6H-pentaleno[1,2-b]pyran is c1coc2c3c(cc-2c1)CCC3.
What is the InChIKey of 7,8-dihydro-6H-pentaleno[1,2-b]pyran?
The InChIKey is ZZQREDGFEHKPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c1-3-8-7-9-4-2-6-12-11(9)10(8)5-1/h2,4,6-7H,1,3,5H2.
What are the key properties of 7,8-dihydro-6H-pentaleno[1,2-b]pyran?
7,8-dihydro-6H-pentaleno[1,2-b]pyran has a molecular weight of 158.20 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-6H-pentaleno[1,2-b]pyran is sourced from PubChem (CID 70105470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).