About cyclopentanamine;(4-fluorophenyl)methanamine
cyclopentanamine;(4-fluorophenyl)methanamine (PubChem CID 70105536) has the molecular formula C12H19FN2
and a molecular weight of 210.30 g/mol. Its IUPAC name is cyclopentanamine;(4-fluorophenyl)methanamine.
Molecular Properties
| Compound Name | cyclopentanamine;(4-fluorophenyl)methanamine |
| PubChem CID | 70105536 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | cyclopentanamine;(4-fluorophenyl)methanamine |
| SMILES | NC1CCCC1.NCc1ccc(F)cc1 |
| InChI | InChI=1S/C7H8FN.C5H11N/c8-7-3-1-6(5-9)2-4-7;6-5-3-1-2-4-5/h1-4H,5,9H2;5H,1-4,6H2 |
| InChIKey | NFJWCTQJRJFOOH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentanamine;(4-fluorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanamine;(4-fluorophenyl)methanamine?
The IUPAC name of cyclopentanamine;(4-fluorophenyl)methanamine (CID 70105536) is cyclopentanamine;(4-fluorophenyl)methanamine.
What is the SMILES notation for cyclopentanamine;(4-fluorophenyl)methanamine?
The canonical SMILES for cyclopentanamine;(4-fluorophenyl)methanamine is NC1CCCC1.NCc1ccc(F)cc1.
What is the InChIKey of cyclopentanamine;(4-fluorophenyl)methanamine?
The InChIKey is NFJWCTQJRJFOOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN.C5H11N/c8-7-3-1-6(5-9)2-4-7;6-5-3-1-2-4-5/h1-4H,5,9H2;5H,1-4,6H2.
What are the key properties of cyclopentanamine;(4-fluorophenyl)methanamine?
cyclopentanamine;(4-fluorophenyl)methanamine has a molecular weight of 210.30 g/mol, XLogP of 2.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanamine;(4-fluorophenyl)methanamine is sourced from PubChem (CID 70105536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).