C14H28N2 — CID 70106252
2-heptyl-3,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyridine (PubChem CID 70106252) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-heptyl-3,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyridine.
| Compound Name | 2-heptyl-3,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 70106252 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-heptyl-3,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyridine |
| SMILES | CCCCCCCN1CC2CCCCN2C1 |
| InChI | InChI=1S/C14H28N2/c1-2-3-4-5-7-10-15-12-14-9-6-8-11-16(14)13-15/h14H,2-13H2,1H3 |
| InChIKey | KQBMMPBALQIJOR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|