C16H12N2O2S — CID 701070
N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 701070) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 701070 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCc1ccccc1-2)c1ccco1 |
| InChI | InChI=1S/C16H12N2O2S/c19-15(12-6-3-9-20-12)18-16-17-14-11-5-2-1-4-10(11)7-8-13(14)21-16/h1-6,9H,7-8H2,(H,17,18,19) |
| InChIKey | FKEDHMSGKDAXGN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |