C18H35NO — CID 70107117
(1S,2S)-2-amino-1-[1-[(2S)-4-methyl-2-propan-2-ylpent-3-enyl]cyclohexyl]propan-1-ol (PubChem CID 70107117) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-[1-[(2S)-4-methyl-2-propan-2-ylpent-3-enyl]cyclohexyl]propan-1-ol.
| Compound Name | (1S,2S)-2-amino-1-[1-[(2S)-4-methyl-2-propan-2-ylpent-3-enyl]cyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 70107117 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | (1S,2S)-2-amino-1-[1-[(2S)-4-methyl-2-propan-2-ylpent-3-enyl]cyclohexyl]propan-1-ol |
| SMILES | CC(C)=C[C@@H](CC1([C@H](O)[C@H](C)N)CCCCC1)C(C)C |
| InChI | InChI=1S/C18H35NO/c1-13(2)11-16(14(3)4)12-18(17(20)15(5)19)9-7-6-8-10-18/h11,14-17,20H,6-10,12,19H2,1-5H3/t15-,16-,17+/m0/s1 |
| InChIKey | BUAIZXWPSMDHKE-YESZJQIVSA-N |
| XLogP | 4.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|