About 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one
2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one (PubChem CID 70107181) has the molecular formula C6H5N5O
and a molecular weight of 163.14 g/mol. Its IUPAC name is 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one |
| PubChem CID | 70107181 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one |
| SMILES | O=C1CC=NN1c1nccnn1 |
| InChI | InChI=1S/C6H5N5O/c12-5-1-2-9-11(5)6-7-3-4-8-10-6/h2-4H,1H2 |
| InChIKey | AHMYXRACGXRRKO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one?
The IUPAC name of 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one (CID 70107181) is 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one.
What is the SMILES notation for 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one?
The canonical SMILES for 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one is O=C1CC=NN1c1nccnn1.
What is the InChIKey of 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one?
The InChIKey is AHMYXRACGXRRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O/c12-5-1-2-9-11(5)6-7-3-4-8-10-6/h2-4H,1H2.
What are the key properties of 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one?
2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one has a molecular weight of 163.14 g/mol, XLogP of -0.41, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazin-3-yl)-4H-pyrazol-3-one is sourced from PubChem (CID 70107181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).