About 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol
4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol (PubChem CID 70107402) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol.
Molecular Properties
| Compound Name | 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol |
| PubChem CID | 70107402 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol |
| SMILES | OCCCCNC(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C15H21NO3/c17-9-5-4-8-16-15(13-6-2-1-3-7-13)14-12-18-10-11-19-14/h1-2,6,10-12,15-17H,3-5,7-9H2 |
| InChIKey | WDOSDLJMADYOSX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol?
The IUPAC name of 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol (CID 70107402) is 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol.
What is the SMILES notation for 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol?
The canonical SMILES for 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol is OCCCCNC(C1=CC=CCC1)C1=COC=CO1.
What is the InChIKey of 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol?
The InChIKey is WDOSDLJMADYOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c17-9-5-4-8-16-15(13-6-2-1-3-7-13)14-12-18-10-11-19-14/h1-2,6,10-12,15-17H,3-5,7-9H2.
What are the key properties of 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol?
4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol has a molecular weight of 263.34 g/mol, XLogP of 2.35, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]amino]butan-1-ol is sourced from PubChem (CID 70107402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).