C27H39N3O2 — CID 70107779
6-ethyl-8a-(3-hydroxyphenyl)-3-methyl-N,N-dipropyl-4,4a,5,7,8,9-hexahydropyrrolo[2,3-g]isoquinoline-1-carboxamide (PubChem CID 70107779) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 6-ethyl-8a-(3-hydroxyphenyl)-3-methyl-N,N-dipropyl-4,4a,5,7,8,9-hexahydropyrrolo[2,3-g]isoquinoline-1-carboxamide.
| Compound Name | 6-ethyl-8a-(3-hydroxyphenyl)-3-methyl-N,N-dipropyl-4,4a,5,7,8,9-hexahydropyrrolo[2,3-g]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 70107779 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 6-ethyl-8a-(3-hydroxyphenyl)-3-methyl-N,N-dipropyl-4,4a,5,7,8,9-hexahydropyrrolo[2,3-g]isoquinoline-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)n1cc(C)c2c1CC1(c3cccc(O)c3)CCN(CC)CC1C2 |
| InChI | InChI=1S/C27H39N3O2/c1-5-12-29(13-6-2)26(32)30-18-20(4)24-16-22-19-28(7-3)14-11-27(22,17-25(24)30)21-9-8-10-23(31)15-21/h8-10,15,18,22,31H,5-7,11-14,16-17,19H2,1-4H3 |
| InChIKey | VLPNLOZKHSDAJK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |