About 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid
8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid (PubChem CID 70108046) has the molecular formula C19H14FN3O4
and a molecular weight of 367.34 g/mol. Its IUPAC name is 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid.
Molecular Properties
| Compound Name | 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid |
| PubChem CID | 70108046 |
| Molecular Formula | C19H14FN3O4 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid |
| SMILES | COCn1c2ccc(F)cc2c2c(C(=O)O)nn(-c3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C19H14FN3O4/c1-27-10-22-14-8-7-11(20)9-13(14)15-16(19(25)26)21-23(18(24)17(15)22)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,25,26) |
| InChIKey | KJVIVJBORKKOPR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid?
The IUPAC name of 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid (CID 70108046) is 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid.
What is the SMILES notation for 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid?
The canonical SMILES for 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid is COCn1c2ccc(F)cc2c2c(C(=O)O)nn(-c3ccccc3)c(=O)c21.
What is the InChIKey of 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid?
The InChIKey is KJVIVJBORKKOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3O4/c1-27-10-22-14-8-7-11(20)9-13(14)15-16(19(25)26)21-23(18(24)17(15)22)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,25,26).
What are the key properties of 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid?
8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid has a molecular weight of 367.34 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-(methoxymethyl)-4-oxo-3-phenylpyridazino[4,5-b]indole-1-carboxylic acid is sourced from PubChem (CID 70108046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).