C24H17F2N5O2 — CID 70108681
1-[7-(4-fluorophenyl)-8-(2-fluoro-4-pyridinyl)-3,4-dihydro-2H-pyrazolo[5,1-c][1,2,4]triazin-1-yl]-2-phenylethane-1,2-dione (PubChem CID 70108681) has the molecular formula C24H17F2N5O2 and a molecular weight of 445.43 g/mol. Its IUPAC name is 1-[7-(4-fluorophenyl)-8-(2-fluoro-4-pyridinyl)-3,4-dihydro-2H-pyrazolo[5,1-c][1,2,4]triazin-1-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[7-(4-fluorophenyl)-8-(2-fluoro-4-pyridinyl)-3,4-dihydro-2H-pyrazolo[5,1-c][1,2,4]triazin-1-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 70108681 |
| Molecular Formula | C24H17F2N5O2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[7-(4-fluorophenyl)-8-(2-fluoro-4-pyridinyl)-3,4-dihydro-2H-pyrazolo[5,1-c][1,2,4]triazin-1-yl]-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)N1NCCn2nc(-c3ccc(F)cc3)c(-c3ccnc(F)c3)c21)c1ccccc1 |
| InChI | InChI=1S/C24H17F2N5O2/c25-18-8-6-15(7-9-18)21-20(17-10-11-27-19(26)14-17)23-30(29-21)13-12-28-31(23)24(33)22(32)16-4-2-1-3-5-16/h1-11,14,28H,12-13H2 |
| InChIKey | WTHDRFNUGZLUHA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|