About 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol
4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol (PubChem CID 70108755) has the molecular formula C15H18FNOS
and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol |
| PubChem CID | 70108755 |
| Molecular Formula | C15H18FNOS |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol |
| SMILES | CC1CC(O)(c2c(F)ccc3ccsc23)CCN1C |
| InChI | InChI=1S/C15H18FNOS/c1-10-9-15(18,6-7-17(10)2)13-12(16)4-3-11-5-8-19-14(11)13/h3-5,8,10,18H,6-7,9H2,1-2H3 |
| InChIKey | OJJPBSCMXYHMBJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol?
The IUPAC name of 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol (CID 70108755) is 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol.
What is the SMILES notation for 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol?
The canonical SMILES for 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol is CC1CC(O)(c2c(F)ccc3ccsc23)CCN1C.
What is the InChIKey of 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol?
The InChIKey is OJJPBSCMXYHMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FNOS/c1-10-9-15(18,6-7-17(10)2)13-12(16)4-3-11-5-8-19-14(11)13/h3-5,8,10,18H,6-7,9H2,1-2H3.
What are the key properties of 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol?
4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol has a molecular weight of 279.38 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-1-benzothiophen-7-yl)-1,2-dimethylpiperidin-4-ol is sourced from PubChem (CID 70108755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).