C26H35N7O4 — CID 70109013
methyl N-[(2S)-1-[[4-[amino-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 70109013) has the molecular formula C26H35N7O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[4-[amino-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[4-[amino-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70109013 |
| Molecular Formula | C26H35N7O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | methyl N-[(2S)-1-[[4-[amino-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)NC(Cc1ccccc1)C(O)CN(N)Cc1ccc(-n2cncn2)cc1)C(C)C |
| InChI | InChI=1S/C26H35N7O4/c1-18(2)24(31-26(36)37-3)25(35)30-22(13-19-7-5-4-6-8-19)23(34)15-32(27)14-20-9-11-21(12-10-20)33-17-28-16-29-33/h4-12,16-18,22-24,34H,13-15,27H2,1-3H3,(H,30,35)(H,31,36)/t22?,23?,24-/m0/s1 |
| InChIKey | BFXGHWOIFWWXSZ-VHYCJAOWSA-N |
| XLogP | 1.41 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|