C11H14N3S+ — CID 701091
N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine (PubChem CID 701091) has the molecular formula C11H14N3S+ and a molecular weight of 220.32 g/mol. Its IUPAC name is N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine.
| Compound Name | N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine |
|---|---|
| PubChem CID | 701091 |
| Molecular Formula | C11H14N3S+ |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine |
| SMILES | CN(C)c1nc(-c2ccccc2)[n+](C)s1 |
| InChI | InChI=1S/C11H14N3S/c1-13(2)11-12-10(14(3)15-11)9-7-5-4-6-8-9/h4-8H,1-3H3/q+1 |
| InChIKey | GLOHANSTICKTGM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|