About prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate
prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate (PubChem CID 70109437) has the molecular formula C11H14N4O4S2
and a molecular weight of 330.39 g/mol. Its IUPAC name is prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate |
| PubChem CID | 70109437 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate |
| SMILES | C=CCOC(=O)N(C)S(=O)(=O)c1c(CN)sc2cncn12 |
| InChI | InChI=1S/C11H14N4O4S2/c1-3-4-19-11(16)14(2)21(17,18)10-8(5-12)20-9-6-13-7-15(9)10/h3,6-7H,1,4-5,12H2,2H3 |
| InChIKey | PUFSDWFDROBYFP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate?
The IUPAC name of prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate (CID 70109437) is prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate.
What is the SMILES notation for prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate?
The canonical SMILES for prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate is C=CCOC(=O)N(C)S(=O)(=O)c1c(CN)sc2cncn12.
What is the InChIKey of prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate?
The InChIKey is PUFSDWFDROBYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O4S2/c1-3-4-19-11(16)14(2)21(17,18)10-8(5-12)20-9-6-13-7-15(9)10/h3,6-7H,1,4-5,12H2,2H3.
What are the key properties of prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate?
prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate has a molecular weight of 330.39 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-[2-(aminomethyl)imidazo[5,1-b][1,3]thiazol-3-yl]sulfonyl-N-methylcarbamate is sourced from PubChem (CID 70109437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).