C11H12FNO2 — CID 70109836
1-[(3-fluorophenoxy)methyl]pyrrolidin-2-one (PubChem CID 70109836) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 1-[(3-fluorophenoxy)methyl]pyrrolidin-2-one.
| Compound Name | 1-[(3-fluorophenoxy)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 70109836 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-[(3-fluorophenoxy)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1COc1cccc(F)c1 |
| InChI | InChI=1S/C11H12FNO2/c12-9-3-1-4-10(7-9)15-8-13-6-2-5-11(13)14/h1,3-4,7H,2,5-6,8H2 |
| InChIKey | BBSOXVCBKOXZJH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |