C18H26N2O3 — CID 70109953
tert-butyl 2-(azetidin-3-yl)-2-(N-propanoylanilino)acetate (PubChem CID 70109953) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl 2-(azetidin-3-yl)-2-(N-propanoylanilino)acetate.
| Compound Name | tert-butyl 2-(azetidin-3-yl)-2-(N-propanoylanilino)acetate |
|---|---|
| PubChem CID | 70109953 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl 2-(azetidin-3-yl)-2-(N-propanoylanilino)acetate |
| SMILES | CCC(=O)N(c1ccccc1)C(C(=O)OC(C)(C)C)C1CNC1 |
| InChI | InChI=1S/C18H26N2O3/c1-5-15(21)20(14-9-7-6-8-10-14)16(13-11-19-12-13)17(22)23-18(2,3)4/h6-10,13,16,19H,5,11-12H2,1-4H3 |
| InChIKey | XKCLPBDSCNALDM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |