C18H26ClNO4 — CID 70110338
ethyl 4-[3-(4-chlorophenoxy)propylamino]-4-oxo-2-propan-2-ylbutanoate (PubChem CID 70110338) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is ethyl 4-[3-(4-chlorophenoxy)propylamino]-4-oxo-2-propan-2-ylbutanoate.
| Compound Name | ethyl 4-[3-(4-chlorophenoxy)propylamino]-4-oxo-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 70110338 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | ethyl 4-[3-(4-chlorophenoxy)propylamino]-4-oxo-2-propan-2-ylbutanoate |
| SMILES | CCOC(=O)C(CC(=O)NCCCOc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C18H26ClNO4/c1-4-23-18(22)16(13(2)3)12-17(21)20-10-5-11-24-15-8-6-14(19)7-9-15/h6-9,13,16H,4-5,10-12H2,1-3H3,(H,20,21) |
| InChIKey | RJZRGWYKBMDVJX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|