C30H30FN5O2 — CID 70110388
6-(4-fluorophenyl)-N,N-dimethyl-3-[6-(2-methylimidazo[4,5-c]pyridin-3-yl)hexanoyl]-1H-indole-2-carboxamide (PubChem CID 70110388) has the molecular formula C30H30FN5O2 and a molecular weight of 511.60 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N,N-dimethyl-3-[6-(2-methylimidazo[4,5-c]pyridin-3-yl)hexanoyl]-1H-indole-2-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-N,N-dimethyl-3-[6-(2-methylimidazo[4,5-c]pyridin-3-yl)hexanoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70110388 |
| Molecular Formula | C30H30FN5O2 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 6-(4-fluorophenyl)-N,N-dimethyl-3-[6-(2-methylimidazo[4,5-c]pyridin-3-yl)hexanoyl]-1H-indole-2-carboxamide |
| SMILES | Cc1nc2ccncc2n1CCCCCC(=O)c1c(C(=O)N(C)C)[nH]c2cc(-c3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C30H30FN5O2/c1-19-33-24-14-15-32-18-26(24)36(19)16-6-4-5-7-27(37)28-23-13-10-21(20-8-11-22(31)12-9-20)17-25(23)34-29(28)30(38)35(2)3/h8-15,17-18,34H,4-7,16H2,1-3H3 |
| InChIKey | DGWQJJMGMZUBCT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|