C14H19N3O4S — CID 701105
methyl 5-ethyl-2-[[2-[(2R)-3-oxopiperazin-2-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 701105) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is methyl 5-ethyl-2-[[2-[(2R)-3-oxopiperazin-2-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[[2-[(2R)-3-oxopiperazin-2-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 701105 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 5-ethyl-2-[[2-[(2R)-3-oxopiperazin-2-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=O)C[C@H]2NCCNC2=O)s1 |
| InChI | InChI=1S/C14H19N3O4S/c1-3-8-6-9(14(20)21-2)13(22-8)17-11(18)7-10-12(19)16-5-4-15-10/h6,10,15H,3-5,7H2,1-2H3,(H,16,19)(H,17,18)/t10-/m1/s1 |
| InChIKey | FSAFRCNYUVBZLK-SNVBAGLBSA-N |
| XLogP | 0.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |