C19H32N2O7 — CID 70111108
1-O-ethyl 3-O-prop-2-enyl 2-[[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]methylamino]propanedioate (PubChem CID 70111108) has the molecular formula C19H32N2O7 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-O-ethyl 3-O-prop-2-enyl 2-[[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]methylamino]propanedioate.
| Compound Name | 1-O-ethyl 3-O-prop-2-enyl 2-[[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]methylamino]propanedioate |
|---|---|
| PubChem CID | 70111108 |
| Molecular Formula | C19H32N2O7 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-O-ethyl 3-O-prop-2-enyl 2-[[(4R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]methylamino]propanedioate |
| SMILES | C=CCOC(=O)C(NC[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H32N2O7/c1-8-10-26-16(23)14(15(22)25-9-2)20-11-13-12-27-19(6,7)21(13)17(24)28-18(3,4)5/h8,13-14,20H,1,9-12H2,2-7H3/t13-,14?/m1/s1 |
| InChIKey | UUNJTUKUEMWYBW-KWCCSABGSA-N |
| XLogP | 1.61 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|