About 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline
6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 70111228) has the molecular formula C21H18F3NO2
and a molecular weight of 373.37 g/mol. Its IUPAC name is 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline.
Molecular Properties
| Compound Name | 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline |
| PubChem CID | 70111228 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | CCN1C=Cc2cc3c(cc2C1C=Cc1ccc(C(F)(F)F)cc1)OCO3 |
| InChI | InChI=1S/C21H18F3NO2/c1-2-25-10-9-15-11-19-20(27-13-26-19)12-17(15)18(25)8-5-14-3-6-16(7-4-14)21(22,23)24/h3-12,18H,2,13H2,1H3 |
| InChIKey | SLNHDESRYWLCIS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline?
The IUPAC name of 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline (CID 70111228) is 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline.
What is the SMILES notation for 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline?
The canonical SMILES for 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline is CCN1C=Cc2cc3c(cc2C1C=Cc1ccc(C(F)(F)F)cc1)OCO3.
What is the InChIKey of 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline?
The InChIKey is SLNHDESRYWLCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3NO2/c1-2-25-10-9-15-11-19-20(27-13-26-19)12-17(15)18(25)8-5-14-3-6-16(7-4-14)21(22,23)24/h3-12,18H,2,13H2,1H3.
What are the key properties of 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline?
6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline has a molecular weight of 373.37 g/mol, XLogP of 5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-5H-[1,3]dioxolo[4,5-g]isoquinoline is sourced from PubChem (CID 70111228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).