C41H40O15 — CID 70111774
(8-acetyloxy-4-hydroxy-4-methoxy-3-phenyl-2,3-dihydrochromen-7-yl) acetate;[4-(7,8-diacetyloxy-4-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate (PubChem CID 70111774) has the molecular formula C41H40O15 and a molecular weight of 772.76 g/mol. Its IUPAC name is (8-acetyloxy-4-hydroxy-4-methoxy-3-phenyl-2,3-dihydrochromen-7-yl) acetate;[4-(7,8-diacetyloxy-4-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate.
| Compound Name | (8-acetyloxy-4-hydroxy-4-methoxy-3-phenyl-2,3-dihydrochromen-7-yl) acetate;[4-(7,8-diacetyloxy-4-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate |
|---|---|
| PubChem CID | 70111774 |
| Molecular Formula | C41H40O15 |
| Molecular Weight | 772.76 g/mol |
| Exact Mass | 772.24 |
| IUPAC Name | (8-acetyloxy-4-hydroxy-4-methoxy-3-phenyl-2,3-dihydrochromen-7-yl) acetate;[4-(7,8-diacetyloxy-4-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2COc3c(ccc(OC(C)=O)c3OC(C)=O)C2O)cc1.COC1(O)c2ccc(OC(C)=O)c(OC(C)=O)c2OCC1c1ccccc1 |
| InChI | InChI=1S/C21H20O8.C20H20O7/c1-11(22)27-15-6-4-14(5-7-15)17-10-26-20-16(19(17)25)8-9-18(28-12(2)23)21(20)29-13(3)24;1-12(21)26-17-10-9-15-18(19(17)27-13(2)22)25-11-16(20(15,23)24-3)14-7-5-4-6-8-14/h4-9,17,19,25H,10H2,1-3H3;4-10,16,23H,11H2,1-3H3 |
| InChIKey | XJBBORMPOZEOIZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 199.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|