About 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine
6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine (PubChem CID 70111819) has the molecular formula C9H11N3S
and a molecular weight of 193.28 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine |
| PubChem CID | 70111819 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine |
| SMILES | CSc1ncc2c(n1)NCC(C)=C2 |
| InChI | InChI=1S/C9H11N3S/c1-6-3-7-5-11-9(13-2)12-8(7)10-4-6/h3,5H,4H2,1-2H3,(H,10,11,12) |
| InChIKey | HYVMMNBRRXONPE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine?
The IUPAC name of 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine (CID 70111819) is 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine.
What is the SMILES notation for 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine?
The canonical SMILES for 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine is CSc1ncc2c(n1)NCC(C)=C2.
What is the InChIKey of 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine?
The InChIKey is HYVMMNBRRXONPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S/c1-6-3-7-5-11-9(13-2)12-8(7)10-4-6/h3,5H,4H2,1-2H3,(H,10,11,12).
What are the key properties of 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine?
6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine has a molecular weight of 193.28 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-methylsulfanyl-7,8-dihydropyrido[2,3-d]pyrimidine is sourced from PubChem (CID 70111819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).