C19H19N3O4 — CID 70112383
5-(2-hydroxy-5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione (PubChem CID 70112383) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-(2-hydroxy-5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(2-hydroxy-5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70112383 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 5-(2-hydroxy-5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)CCc1oc(C)nc1C2(O)c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H19N3O4/c1-10-4-6-13-12(8-10)5-7-15-16(20-11(2)26-15)19(13,25)14-9-22(3)18(24)21-17(14)23/h4,6,8-9,25H,5,7H2,1-3H3,(H,21,23,24) |
| InChIKey | LGXSCXWFSIWKCM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |