About (5-butyl-1,3-oxazol-2-yl)methanol
(5-butyl-1,3-oxazol-2-yl)methanol (PubChem CID 70112422) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (5-butyl-1,3-oxazol-2-yl)methanol.
Molecular Properties
| Compound Name | (5-butyl-1,3-oxazol-2-yl)methanol |
| PubChem CID | 70112422 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (5-butyl-1,3-oxazol-2-yl)methanol |
| SMILES | CCCCc1cnc(CO)o1 |
| InChI | InChI=1S/C8H13NO2/c1-2-3-4-7-5-9-8(6-10)11-7/h5,10H,2-4,6H2,1H3 |
| InChIKey | SCFXQCKIVNNVIK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-butyl-1,3-oxazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-butyl-1,3-oxazol-2-yl)methanol?
The IUPAC name of (5-butyl-1,3-oxazol-2-yl)methanol (CID 70112422) is (5-butyl-1,3-oxazol-2-yl)methanol.
What is the SMILES notation for (5-butyl-1,3-oxazol-2-yl)methanol?
The canonical SMILES for (5-butyl-1,3-oxazol-2-yl)methanol is CCCCc1cnc(CO)o1.
What is the InChIKey of (5-butyl-1,3-oxazol-2-yl)methanol?
The InChIKey is SCFXQCKIVNNVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-3-4-7-5-9-8(6-10)11-7/h5,10H,2-4,6H2,1H3.
What are the key properties of (5-butyl-1,3-oxazol-2-yl)methanol?
(5-butyl-1,3-oxazol-2-yl)methanol has a molecular weight of 155.20 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-butyl-1,3-oxazol-2-yl)methanol is sourced from PubChem (CID 70112422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).