About propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride
propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride (PubChem CID 70112506) has the molecular formula C15H21ClN2O2
and a molecular weight of 296.80 g/mol. Its IUPAC name is propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride |
| PubChem CID | 70112506 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(/Cc1cn(C)c2cc(OC)ccc12)OC(C)C |
| InChI | InChI=1S/C15H20N2O2.ClH/c1-10(2)19-15(16)7-11-9-17(3)14-8-12(18-4)5-6-13(11)14;/h5-6,8-10,16H,7H2,1-4H3;1H/b16-15-; |
| InChIKey | NXSKAFXOBAPOFO-YFKNTREVSA-N |
| XLogP | 3.55 |
| TPSA | 47.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride?
The IUPAC name of propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride (CID 70112506) is propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride.
What is the SMILES notation for propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride?
The canonical SMILES for propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride is Cl.[H]/N=C(/Cc1cn(C)c2cc(OC)ccc12)OC(C)C.
What is the InChIKey of propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride?
The InChIKey is NXSKAFXOBAPOFO-YFKNTREVSA-N. The full InChI is InChI=1S/C15H20N2O2.ClH/c1-10(2)19-15(16)7-11-9-17(3)14-8-12(18-4)5-6-13(11)14;/h5-6,8-10,16H,7H2,1-4H3;1H/b16-15-;.
What are the key properties of propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride?
propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride has a molecular weight of 296.80 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(6-methoxy-1-methylindol-3-yl)ethanimidate;hydrochloride is sourced from PubChem (CID 70112506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).