C18H14ClN3O3 — CID 70112512
5-(12-chloro-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione (PubChem CID 70112512) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is 5-(12-chloro-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(12-chloro-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70112512 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 5-(12-chloro-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cc1nc2c(o1)C=Cc1cc(Cl)ccc1C2c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H14ClN3O3/c1-9-20-16-14(25-9)6-3-10-7-11(19)4-5-12(10)15(16)13-8-22(2)18(24)21-17(13)23/h3-8,15H,1-2H3,(H,21,23,24) |
| InChIKey | FSZHIZKIUHTEHY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |