C18H16ClN3O4 — CID 70112767
5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione (PubChem CID 70112767) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70112767 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cc1nc2c(o1)CCc1cc(Cl)ccc1C2(O)c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H16ClN3O4/c1-9-20-15-14(26-9)6-3-10-7-11(19)4-5-12(10)18(15,25)13-8-22(2)17(24)21-16(13)23/h4-5,7-8,25H,3,6H2,1-2H3,(H,21,23,24) |
| InChIKey | JOELWWDQOVZJEY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |