C18H15N3O3 — CID 70112978
1-methyl-5-(5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-yl)pyrimidine-2,4-dione (PubChem CID 70112978) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-methyl-5-(5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-yl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-(5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70112978 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-methyl-5-(5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-yl)pyrimidine-2,4-dione |
| SMILES | Cc1nc2c(o1)C=Cc1ccccc1C2c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H15N3O3/c1-10-19-16-14(24-10)8-7-11-5-3-4-6-12(11)15(16)13-9-21(2)18(23)20-17(13)22/h3-9,15H,1-2H3,(H,20,22,23) |
| InChIKey | HUPJXBOKBJSEJO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |