C19H17N3O3 — CID 70112980
5-(5-ethyl-12-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione (PubChem CID 70112980) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-(5-ethyl-12-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(5-ethyl-12-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70112980 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-(5-ethyl-12-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1H-pyrimidine-2,4-dione |
| SMILES | CCc1nc2c(o1)C=Cc1cc(C)ccc1C2c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H17N3O3/c1-3-15-21-17-14(25-15)7-5-11-8-10(2)4-6-12(11)16(17)13-9-20-19(24)22-18(13)23/h4-9,16H,3H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | NOUSMXFIHIVVLN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |