C26H25N3O — CID 7011305
(4S)-1-(4-methylphenyl)-4-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 7011305) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is (4S)-1-(4-methylphenyl)-4-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(4-methylphenyl)-4-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 7011305 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (4S)-1-(4-methylphenyl)-4-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | Cc1ccc(N2C[C@@H](c3nc4ccccc4n3Cc3ccccc3C)CC2=O)cc1 |
| InChI | InChI=1S/C26H25N3O/c1-18-11-13-22(14-12-18)28-17-21(15-25(28)30)26-27-23-9-5-6-10-24(23)29(26)16-20-8-4-3-7-19(20)2/h3-14,21H,15-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | PMXYQTVJESWTRC-NRFANRHFSA-N |
| XLogP | 5.22 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |