C13H23N3O4S3 — CID 70113062
(4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 70113062) has the molecular formula C13H23N3O4S3 and a molecular weight of 381.55 g/mol. Its IUPAC name is (4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 70113062 |
| Molecular Formula | C13H23N3O4S3 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (4R)-4-(ethylamino)-2-[2-(1-methoxyethoxy)ethyl]-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCN[C@H]1CN(CCOC(C)OC)Sc2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C13H23N3O4S3/c1-4-15-11-8-16(5-6-20-9(2)19-3)22-13-10(11)7-12(21-13)23(14,17)18/h7,9,11,15H,4-6,8H2,1-3H3,(H2,14,17,18)/t9?,11-/m0/s1 |
| InChIKey | LBSPKQUUCHPJIA-UMJHXOGRSA-N |
| XLogP | 1.38 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|