C17H14ClN3O4 — CID 70113129
5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1H-pyrimidine-2,4-dione (PubChem CID 70113129) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is 5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70113129 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 5-(12-chloro-2-hydroxy-5-methyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-yl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1nc2c(o1)CCc1cc(Cl)ccc1C2(O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H14ClN3O4/c1-8-20-14-13(25-8)5-2-9-6-10(18)3-4-11(9)17(14,24)12-7-19-16(23)21-15(12)22/h3-4,6-7,24H,2,5H2,1H3,(H2,19,21,22,23) |
| InChIKey | SQCDEFBBIXSGFY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |