C10H12N2O3 — CID 70113185
N-[1-(2,5-dioxopyrrol-3-yl)propyl]prop-2-enamide (PubChem CID 70113185) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-[1-(2,5-dioxopyrrol-3-yl)propyl]prop-2-enamide.
| Compound Name | N-[1-(2,5-dioxopyrrol-3-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 70113185 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-[1-(2,5-dioxopyrrol-3-yl)propyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(CC)C1=CC(=O)NC1=O |
| InChI | InChI=1S/C10H12N2O3/c1-3-7(11-8(13)4-2)6-5-9(14)12-10(6)15/h4-5,7H,2-3H2,1H3,(H,11,13)(H,12,14,15) |
| InChIKey | ZBGUODUZCNVQQY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|